C18H34O3Si2 — CID 122393367
(1R)-1-[(3S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,6-dihydro-2H-pyran-3-yl]-3-trimethylsilylprop-2-yn-1-ol (PubChem CID 122393367) has the molecular formula C18H34O3Si2 and a molecular weight of 354.64 g/mol. Its IUPAC name is (1R)-1-[(3S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,6-dihydro-2H-pyran-3-yl]-3-trimethylsilylprop-2-yn-1-ol.
| Compound Name | (1R)-1-[(3S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,6-dihydro-2H-pyran-3-yl]-3-trimethylsilylprop-2-yn-1-ol |
|---|---|
| PubChem CID | 122393367 |
| Molecular Formula | C18H34O3Si2 |
| Molecular Weight | 354.64 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | (1R)-1-[(3S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,6-dihydro-2H-pyran-3-yl]-3-trimethylsilylprop-2-yn-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1C=C[C@H]([C@@H](O)C#C[Si](C)(C)C)CO1 |
| InChI | InChI=1S/C18H34O3Si2/c1-18(2,3)23(7,8)21-14-16-10-9-15(13-20-16)17(19)11-12-22(4,5)6/h9-10,15-17,19H,13-14H2,1-8H3/t15-,16-,17-/m0/s1 |
| InChIKey | BXCDAEGEXYMWKB-ULQDDVLXSA-N |
| XLogP | 3.82 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.64 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|