About (1R,3S)-2-oxatricyclo[3.3.1.13,7]decan-5-amine
(1R,3S)-2-oxatricyclo[3.3.1.13,7]decan-5-amine (PubChem CID 122393445) has the molecular formula C9H15NO
and a molecular weight of 153.22 g/mol. Its IUPAC name is (1R,3S)-2-oxatricyclo[3.3.1.13,7]decan-5-amine.
Molecular Properties
| Compound Name | (1R,3S)-2-oxatricyclo[3.3.1.13,7]decan-5-amine |
| PubChem CID | 122393445 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | (1R,3S)-2-oxatricyclo[3.3.1.13,7]decan-5-amine |
| SMILES | NC12CC3C[C@H](C1)O[C@@H](C3)C2 |
| InChI | InChI=1S/C9H15NO/c10-9-3-6-1-7(4-9)11-8(2-6)5-9/h6-8H,1-5,10H2/t6?,7-,8+,9? |
| InChIKey | NYHSVISZABWUIA-VGKQMMLZSA-N |
| XLogP | 1.05 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1R,3S)-2-oxatricyclo[3.3.1.13,7]decan-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,3S)-2-oxatricyclo[3.3.1.13,7]decan-5-amine?
The IUPAC name of (1R,3S)-2-oxatricyclo[3.3.1.13,7]decan-5-amine (CID 122393445) is (1R,3S)-2-oxatricyclo[3.3.1.13,7]decan-5-amine.
What is the SMILES notation for (1R,3S)-2-oxatricyclo[3.3.1.13,7]decan-5-amine?
The canonical SMILES for (1R,3S)-2-oxatricyclo[3.3.1.13,7]decan-5-amine is NC12CC3C[C@H](C1)O[C@@H](C3)C2.
What is the InChIKey of (1R,3S)-2-oxatricyclo[3.3.1.13,7]decan-5-amine?
The InChIKey is NYHSVISZABWUIA-VGKQMMLZSA-N. The full InChI is InChI=1S/C9H15NO/c10-9-3-6-1-7(4-9)11-8(2-6)5-9/h6-8H,1-5,10H2/t6?,7-,8+,9?.
What are the key properties of (1R,3S)-2-oxatricyclo[3.3.1.13,7]decan-5-amine?
(1R,3S)-2-oxatricyclo[3.3.1.13,7]decan-5-amine has a molecular weight of 153.22 g/mol, XLogP of 1.05, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,3S)-2-oxatricyclo[3.3.1.13,7]decan-5-amine is sourced from PubChem (CID 122393445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).