About 2-[1-(dimethylamino)pyrrol-2-yl]-N,N-dimethylpyrrol-1-amine
2-[1-(dimethylamino)pyrrol-2-yl]-N,N-dimethylpyrrol-1-amine (PubChem CID 122393614) has the molecular formula C12H18N4
and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-[1-(dimethylamino)pyrrol-2-yl]-N,N-dimethylpyrrol-1-amine.
Molecular Properties
| Compound Name | 2-[1-(dimethylamino)pyrrol-2-yl]-N,N-dimethylpyrrol-1-amine |
| PubChem CID | 122393614 |
| Molecular Formula | C12H18N4 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | 2-[1-(dimethylamino)pyrrol-2-yl]-N,N-dimethylpyrrol-1-amine |
| SMILES | CN(C)n1cccc1-c1cccn1N(C)C |
| InChI | InChI=1S/C12H18N4/c1-13(2)15-9-5-7-11(15)12-8-6-10-16(12)14(3)4/h5-10H,1-4H3 |
| InChIKey | GUYWXDAOOZCRPT-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 16.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[1-(dimethylamino)pyrrol-2-yl]-N,N-dimethylpyrrol-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(dimethylamino)pyrrol-2-yl]-N,N-dimethylpyrrol-1-amine?
The IUPAC name of 2-[1-(dimethylamino)pyrrol-2-yl]-N,N-dimethylpyrrol-1-amine (CID 122393614) is 2-[1-(dimethylamino)pyrrol-2-yl]-N,N-dimethylpyrrol-1-amine.
What is the SMILES notation for 2-[1-(dimethylamino)pyrrol-2-yl]-N,N-dimethylpyrrol-1-amine?
The canonical SMILES for 2-[1-(dimethylamino)pyrrol-2-yl]-N,N-dimethylpyrrol-1-amine is CN(C)n1cccc1-c1cccn1N(C)C.
What is the InChIKey of 2-[1-(dimethylamino)pyrrol-2-yl]-N,N-dimethylpyrrol-1-amine?
The InChIKey is GUYWXDAOOZCRPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N4/c1-13(2)15-9-5-7-11(15)12-8-6-10-16(12)14(3)4/h5-10H,1-4H3.
What are the key properties of 2-[1-(dimethylamino)pyrrol-2-yl]-N,N-dimethylpyrrol-1-amine?
2-[1-(dimethylamino)pyrrol-2-yl]-N,N-dimethylpyrrol-1-amine has a molecular weight of 218.30 g/mol, XLogP of 1.35, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(dimethylamino)pyrrol-2-yl]-N,N-dimethylpyrrol-1-amine is sourced from PubChem (CID 122393614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).