C17H20O7 — CID 122393832
dimethyl 2-[1-(4-methoxyphenyl)-1,4-dioxopentan-3-yl]propanedioate (PubChem CID 122393832) has the molecular formula C17H20O7 and a molecular weight of 336.34 g/mol. Its IUPAC name is dimethyl 2-[1-(4-methoxyphenyl)-1,4-dioxopentan-3-yl]propanedioate.
| Compound Name | dimethyl 2-[1-(4-methoxyphenyl)-1,4-dioxopentan-3-yl]propanedioate |
|---|---|
| PubChem CID | 122393832 |
| Molecular Formula | C17H20O7 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | dimethyl 2-[1-(4-methoxyphenyl)-1,4-dioxopentan-3-yl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)C(CC(=O)c1ccc(OC)cc1)C(C)=O |
| InChI | InChI=1S/C17H20O7/c1-10(18)13(15(16(20)23-3)17(21)24-4)9-14(19)11-5-7-12(22-2)8-6-11/h5-8,13,15H,9H2,1-4H3 |
| InChIKey | BOHHHMZHKPOBMN-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|