About 4-[4-(4-hydroxyphenyl)-1,1-dioxo-2,5-dihydrothiophen-3-yl]phenol
4-[4-(4-hydroxyphenyl)-1,1-dioxo-2,5-dihydrothiophen-3-yl]phenol (PubChem CID 122394472) has the molecular formula C16H14O4S
and a molecular weight of 302.35 g/mol. Its IUPAC name is 4-[4-(4-hydroxyphenyl)-1,1-dioxo-2,5-dihydrothiophen-3-yl]phenol.
Molecular Properties
| Compound Name | 4-[4-(4-hydroxyphenyl)-1,1-dioxo-2,5-dihydrothiophen-3-yl]phenol |
| PubChem CID | 122394472 |
| Molecular Formula | C16H14O4S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 4-[4-(4-hydroxyphenyl)-1,1-dioxo-2,5-dihydrothiophen-3-yl]phenol |
| SMILES | O=S1(=O)CC(c2ccc(O)cc2)=C(c2ccc(O)cc2)C1 |
| InChI | InChI=1S/C16H14O4S/c17-13-5-1-11(2-6-13)15-9-21(19,20)10-16(15)12-3-7-14(18)8-4-12/h1-8,17-18H,9-10H2 |
| InChIKey | WTIPNJGTHSVJRN-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(4-hydroxyphenyl)-1,1-dioxo-2,5-dihydrothiophen-3-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(4-hydroxyphenyl)-1,1-dioxo-2,5-dihydrothiophen-3-yl]phenol?
The IUPAC name of 4-[4-(4-hydroxyphenyl)-1,1-dioxo-2,5-dihydrothiophen-3-yl]phenol (CID 122394472) is 4-[4-(4-hydroxyphenyl)-1,1-dioxo-2,5-dihydrothiophen-3-yl]phenol.
What is the SMILES notation for 4-[4-(4-hydroxyphenyl)-1,1-dioxo-2,5-dihydrothiophen-3-yl]phenol?
The canonical SMILES for 4-[4-(4-hydroxyphenyl)-1,1-dioxo-2,5-dihydrothiophen-3-yl]phenol is O=S1(=O)CC(c2ccc(O)cc2)=C(c2ccc(O)cc2)C1.
What is the InChIKey of 4-[4-(4-hydroxyphenyl)-1,1-dioxo-2,5-dihydrothiophen-3-yl]phenol?
The InChIKey is WTIPNJGTHSVJRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O4S/c17-13-5-1-11(2-6-13)15-9-21(19,20)10-16(15)12-3-7-14(18)8-4-12/h1-8,17-18H,9-10H2.
What are the key properties of 4-[4-(4-hydroxyphenyl)-1,1-dioxo-2,5-dihydrothiophen-3-yl]phenol?
4-[4-(4-hydroxyphenyl)-1,1-dioxo-2,5-dihydrothiophen-3-yl]phenol has a molecular weight of 302.35 g/mol, XLogP of 2.44, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(4-hydroxyphenyl)-1,1-dioxo-2,5-dihydrothiophen-3-yl]phenol is sourced from PubChem (CID 122394472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).