About (5R,6S)-5'-bromo-1'-methyl-6-phenylspiro[6H-indolizine-5,3'-indole]-2'-one
(5R,6S)-5'-bromo-1'-methyl-6-phenylspiro[6H-indolizine-5,3'-indole]-2'-one (PubChem CID 122394633) has the molecular formula C22H17BrN2O
and a molecular weight of 405.30 g/mol. Its IUPAC name is (5R,6S)-5'-bromo-1'-methyl-6-phenylspiro[6H-indolizine-5,3'-indole]-2'-one.
Molecular Properties
| Compound Name | (5R,6S)-5'-bromo-1'-methyl-6-phenylspiro[6H-indolizine-5,3'-indole]-2'-one |
| PubChem CID | 122394633 |
| Molecular Formula | C22H17BrN2O |
| Molecular Weight | 405.30 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | (5R,6S)-5'-bromo-1'-methyl-6-phenylspiro[6H-indolizine-5,3'-indole]-2'-one |
| SMILES | CN1C(=O)[C@]2(c3cc(Br)ccc31)[C@H](c1ccccc1)C=Cc1cccn12 |
| InChI | InChI=1S/C22H17BrN2O/c1-24-20-12-9-16(23)14-19(20)22(21(24)26)18(15-6-3-2-4-7-15)11-10-17-8-5-13-25(17)22/h2-14,18H,1H3/t18-,22+/m0/s1 |
| InChIKey | SLEWMCNNBHJYDM-PGRDOPGGSA-N |
| XLogP | 4.78 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.30 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5R,6S)-5'-bromo-1'-methyl-6-phenylspiro[6H-indolizine-5,3'-indole]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R,6S)-5'-bromo-1'-methyl-6-phenylspiro[6H-indolizine-5,3'-indole]-2'-one?
The IUPAC name of (5R,6S)-5'-bromo-1'-methyl-6-phenylspiro[6H-indolizine-5,3'-indole]-2'-one (CID 122394633) is (5R,6S)-5'-bromo-1'-methyl-6-phenylspiro[6H-indolizine-5,3'-indole]-2'-one.
What is the SMILES notation for (5R,6S)-5'-bromo-1'-methyl-6-phenylspiro[6H-indolizine-5,3'-indole]-2'-one?
The canonical SMILES for (5R,6S)-5'-bromo-1'-methyl-6-phenylspiro[6H-indolizine-5,3'-indole]-2'-one is CN1C(=O)[C@]2(c3cc(Br)ccc31)[C@H](c1ccccc1)C=Cc1cccn12.
What is the InChIKey of (5R,6S)-5'-bromo-1'-methyl-6-phenylspiro[6H-indolizine-5,3'-indole]-2'-one?
The InChIKey is SLEWMCNNBHJYDM-PGRDOPGGSA-N. The full InChI is InChI=1S/C22H17BrN2O/c1-24-20-12-9-16(23)14-19(20)22(21(24)26)18(15-6-3-2-4-7-15)11-10-17-8-5-13-25(17)22/h2-14,18H,1H3/t18-,22+/m0/s1.
What are the key properties of (5R,6S)-5'-bromo-1'-methyl-6-phenylspiro[6H-indolizine-5,3'-indole]-2'-one?
(5R,6S)-5'-bromo-1'-methyl-6-phenylspiro[6H-indolizine-5,3'-indole]-2'-one has a molecular weight of 405.30 g/mol, XLogP of 4.78, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5R,6S)-5'-bromo-1'-methyl-6-phenylspiro[6H-indolizine-5,3'-indole]-2'-one is sourced from PubChem (CID 122394633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).