C21H26O3Si — CID 122395166
(2S,3R,4R,5S)-4-[dimethyl(phenyl)silyl]-5-(methoxymethyl)-2-phenyloxolane-3-carbaldehyde (PubChem CID 122395166) has the molecular formula C21H26O3Si and a molecular weight of 354.52 g/mol. Its IUPAC name is (2S,3R,4R,5S)-4-[dimethyl(phenyl)silyl]-5-(methoxymethyl)-2-phenyloxolane-3-carbaldehyde.
| Compound Name | (2S,3R,4R,5S)-4-[dimethyl(phenyl)silyl]-5-(methoxymethyl)-2-phenyloxolane-3-carbaldehyde |
|---|---|
| PubChem CID | 122395166 |
| Molecular Formula | C21H26O3Si |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | (2S,3R,4R,5S)-4-[dimethyl(phenyl)silyl]-5-(methoxymethyl)-2-phenyloxolane-3-carbaldehyde |
| SMILES | COC[C@@H]1O[C@H](c2ccccc2)[C@H](C=O)[C@H]1[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C21H26O3Si/c1-23-15-19-21(25(2,3)17-12-8-5-9-13-17)18(14-22)20(24-19)16-10-6-4-7-11-16/h4-14,18-21H,15H2,1-3H3/t18-,19-,20+,21+/m0/s1 |
| InChIKey | NSYINWKPWIIBIZ-UWHLTILDSA-N |
| XLogP | 3.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|