C23H26O2S — CID 122395196
S-methyl (2R,4S)-2-(4-tert-butylphenyl)-4-phenyl-3,4-dihydro-2H-pyran-6-carbothioate (PubChem CID 122395196) has the molecular formula C23H26O2S and a molecular weight of 366.53 g/mol. Its IUPAC name is S-methyl (2R,4S)-2-(4-tert-butylphenyl)-4-phenyl-3,4-dihydro-2H-pyran-6-carbothioate.
| Compound Name | S-methyl (2R,4S)-2-(4-tert-butylphenyl)-4-phenyl-3,4-dihydro-2H-pyran-6-carbothioate |
|---|---|
| PubChem CID | 122395196 |
| Molecular Formula | C23H26O2S |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | S-methyl (2R,4S)-2-(4-tert-butylphenyl)-4-phenyl-3,4-dihydro-2H-pyran-6-carbothioate |
| SMILES | CSC(=O)C1=C[C@@H](c2ccccc2)C[C@H](c2ccc(C(C)(C)C)cc2)O1 |
| InChI | InChI=1S/C23H26O2S/c1-23(2,3)19-12-10-17(11-13-19)20-14-18(16-8-6-5-7-9-16)15-21(25-20)22(24)26-4/h5-13,15,18,20H,14H2,1-4H3/t18-,20+/m0/s1 |
| InChIKey | LYZBJENCUHKUNA-AZUAARDMSA-N |
| XLogP | 6.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|