About 3-[4-(2,4,6-trimethylphenyl)phthalazin-1-yl]selanylpropan-1-ol
3-[4-(2,4,6-trimethylphenyl)phthalazin-1-yl]selanylpropan-1-ol (PubChem CID 122395570) has the molecular formula C20H22N2OSe
and a molecular weight of 385.37 g/mol. Its IUPAC name is 3-[4-(2,4,6-trimethylphenyl)phthalazin-1-yl]selanylpropan-1-ol.
Molecular Properties
| Compound Name | 3-[4-(2,4,6-trimethylphenyl)phthalazin-1-yl]selanylpropan-1-ol |
| PubChem CID | 122395570 |
| Molecular Formula | C20H22N2OSe |
| Molecular Weight | 385.37 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 3-[4-(2,4,6-trimethylphenyl)phthalazin-1-yl]selanylpropan-1-ol |
| SMILES | Cc1cc(C)c(-c2nnc([Se]CCCO)c3ccccc23)c(C)c1 |
| InChI | InChI=1S/C20H22N2OSe/c1-13-11-14(2)18(15(3)12-13)19-16-7-4-5-8-17(16)20(22-21-19)24-10-6-9-23/h4-5,7-8,11-12,23H,6,9-10H2,1-3H3 |
| InChIKey | DFHKAEFPPJHIKD-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-(2,4,6-trimethylphenyl)phthalazin-1-yl]selanylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(2,4,6-trimethylphenyl)phthalazin-1-yl]selanylpropan-1-ol?
The IUPAC name of 3-[4-(2,4,6-trimethylphenyl)phthalazin-1-yl]selanylpropan-1-ol (CID 122395570) is 3-[4-(2,4,6-trimethylphenyl)phthalazin-1-yl]selanylpropan-1-ol.
What is the SMILES notation for 3-[4-(2,4,6-trimethylphenyl)phthalazin-1-yl]selanylpropan-1-ol?
The canonical SMILES for 3-[4-(2,4,6-trimethylphenyl)phthalazin-1-yl]selanylpropan-1-ol is Cc1cc(C)c(-c2nnc([Se]CCCO)c3ccccc23)c(C)c1.
What is the InChIKey of 3-[4-(2,4,6-trimethylphenyl)phthalazin-1-yl]selanylpropan-1-ol?
The InChIKey is DFHKAEFPPJHIKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N2OSe/c1-13-11-14(2)18(15(3)12-13)19-16-7-4-5-8-17(16)20(22-21-19)24-10-6-9-23/h4-5,7-8,11-12,23H,6,9-10H2,1-3H3.
What are the key properties of 3-[4-(2,4,6-trimethylphenyl)phthalazin-1-yl]selanylpropan-1-ol?
3-[4-(2,4,6-trimethylphenyl)phthalazin-1-yl]selanylpropan-1-ol has a molecular weight of 385.37 g/mol, XLogP of 3.35, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(2,4,6-trimethylphenyl)phthalazin-1-yl]selanylpropan-1-ol is sourced from PubChem (CID 122395570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).