C16H20O — CID 122395889
(6Z)-7-ethenyl-8-methyl-8-phenyl-2,3,4,5-tetrahydrooxocine (PubChem CID 122395889) has the molecular formula C16H20O and a molecular weight of 228.34 g/mol. Its IUPAC name is (6Z)-7-ethenyl-8-methyl-8-phenyl-2,3,4,5-tetrahydrooxocine.
| Compound Name | (6Z)-7-ethenyl-8-methyl-8-phenyl-2,3,4,5-tetrahydrooxocine |
|---|---|
| PubChem CID | 122395889 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | (6Z)-7-ethenyl-8-methyl-8-phenyl-2,3,4,5-tetrahydrooxocine |
| SMILES | C=C/C1=C/CCCCOC1(C)c1ccccc1 |
| InChI | InChI=1S/C16H20O/c1-3-14-10-8-5-9-13-17-16(14,2)15-11-6-4-7-12-15/h3-4,6-7,10-12H,1,5,8-9,13H2,2H3/b14-10- |
| InChIKey | DBQBNIWEHRUEIP-UVTDQMKNSA-N |
| XLogP | 4.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |