About butyl 3-(4-fluorobenzoyl)-4,5-dihydro-1,2-oxazole-5-carboxylate
butyl 3-(4-fluorobenzoyl)-4,5-dihydro-1,2-oxazole-5-carboxylate (PubChem CID 122396304) has the molecular formula C15H16FNO4
and a molecular weight of 293.29 g/mol. Its IUPAC name is butyl 3-(4-fluorobenzoyl)-4,5-dihydro-1,2-oxazole-5-carboxylate.
Molecular Properties
| Compound Name | butyl 3-(4-fluorobenzoyl)-4,5-dihydro-1,2-oxazole-5-carboxylate |
| PubChem CID | 122396304 |
| Molecular Formula | C15H16FNO4 |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | butyl 3-(4-fluorobenzoyl)-4,5-dihydro-1,2-oxazole-5-carboxylate |
| SMILES | CCCCOC(=O)C1CC(C(=O)c2ccc(F)cc2)=NO1 |
| InChI | InChI=1S/C15H16FNO4/c1-2-3-8-20-15(19)13-9-12(17-21-13)14(18)10-4-6-11(16)7-5-10/h4-7,13H,2-3,8-9H2,1H3 |
| InChIKey | WNQVVKRJGGJYMX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl 3-(4-fluorobenzoyl)-4,5-dihydro-1,2-oxazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 3-(4-fluorobenzoyl)-4,5-dihydro-1,2-oxazole-5-carboxylate?
The IUPAC name of butyl 3-(4-fluorobenzoyl)-4,5-dihydro-1,2-oxazole-5-carboxylate (CID 122396304) is butyl 3-(4-fluorobenzoyl)-4,5-dihydro-1,2-oxazole-5-carboxylate.
What is the SMILES notation for butyl 3-(4-fluorobenzoyl)-4,5-dihydro-1,2-oxazole-5-carboxylate?
The canonical SMILES for butyl 3-(4-fluorobenzoyl)-4,5-dihydro-1,2-oxazole-5-carboxylate is CCCCOC(=O)C1CC(C(=O)c2ccc(F)cc2)=NO1.
What is the InChIKey of butyl 3-(4-fluorobenzoyl)-4,5-dihydro-1,2-oxazole-5-carboxylate?
The InChIKey is WNQVVKRJGGJYMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16FNO4/c1-2-3-8-20-15(19)13-9-12(17-21-13)14(18)10-4-6-11(16)7-5-10/h4-7,13H,2-3,8-9H2,1H3.
What are the key properties of butyl 3-(4-fluorobenzoyl)-4,5-dihydro-1,2-oxazole-5-carboxylate?
butyl 3-(4-fluorobenzoyl)-4,5-dihydro-1,2-oxazole-5-carboxylate has a molecular weight of 293.29 g/mol, XLogP of 2.50, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 3-(4-fluorobenzoyl)-4,5-dihydro-1,2-oxazole-5-carboxylate is sourced from PubChem (CID 122396304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).