C26H21F2NO3S — CID 122396743
(3E,5E)-3,5-bis[(3-fluorophenyl)methylidene]-1-(4-methylphenyl)sulfonylpiperidin-4-one (PubChem CID 122396743) has the molecular formula C26H21F2NO3S and a molecular weight of 465.52 g/mol. Its IUPAC name is (3E,5E)-3,5-bis[(3-fluorophenyl)methylidene]-1-(4-methylphenyl)sulfonylpiperidin-4-one.
| Compound Name | (3E,5E)-3,5-bis[(3-fluorophenyl)methylidene]-1-(4-methylphenyl)sulfonylpiperidin-4-one |
|---|---|
| PubChem CID | 122396743 |
| Molecular Formula | C26H21F2NO3S |
| Molecular Weight | 465.52 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | (3E,5E)-3,5-bis[(3-fluorophenyl)methylidene]-1-(4-methylphenyl)sulfonylpiperidin-4-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C/C(=C\c3cccc(F)c3)C(=O)/C(=C/c3cccc(F)c3)C2)cc1 |
| InChI | InChI=1S/C26H21F2NO3S/c1-18-8-10-25(11-9-18)33(31,32)29-16-21(12-19-4-2-6-23(27)14-19)26(30)22(17-29)13-20-5-3-7-24(28)15-20/h2-15H,16-17H2,1H3/b21-12+,22-13+ |
| InChIKey | UYESLWCMJRFILP-ADYPVIEZSA-N |
| XLogP | 5.01 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.52 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|