C12H10BrCl2NO2 — CID 122397023
(4S,5S)-4-bromo-3-(2,6-dichlorophenyl)-1,6-dioxa-2-azaspiro[4.4]non-2-ene (PubChem CID 122397023) has the molecular formula C12H10BrCl2NO2 and a molecular weight of 351.03 g/mol. Its IUPAC name is (4S,5S)-4-bromo-3-(2,6-dichlorophenyl)-1,6-dioxa-2-azaspiro[4.4]non-2-ene.
| Compound Name | (4S,5S)-4-bromo-3-(2,6-dichlorophenyl)-1,6-dioxa-2-azaspiro[4.4]non-2-ene |
|---|---|
| PubChem CID | 122397023 |
| Molecular Formula | C12H10BrCl2NO2 |
| Molecular Weight | 351.03 g/mol |
| Exact Mass | 348.93 |
| IUPAC Name | (4S,5S)-4-bromo-3-(2,6-dichlorophenyl)-1,6-dioxa-2-azaspiro[4.4]non-2-ene |
| SMILES | Clc1cccc(Cl)c1C1=NO[C@@]2(CCCO2)[C@H]1Br |
| InChI | InChI=1S/C12H10BrCl2NO2/c13-11-10(9-7(14)3-1-4-8(9)15)16-18-12(11)5-2-6-17-12/h1,3-4,11H,2,5-6H2/t11-,12-/m0/s1 |
| InChIKey | ROYZLNRUHXZLTK-RYUDHWBXSA-N |
| XLogP | 4.00 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.03 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|