C22H34O3 — CID 122397561
[(4S,4aR,4bS,7R,10R,10aS)-7-ethenyl-10-hydroxy-1,1,4a,7-tetramethyl-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthren-4-yl] acetate (PubChem CID 122397561) has the molecular formula C22H34O3 and a molecular weight of 346.51 g/mol. Its IUPAC name is [(4S,4aR,4bS,7R,10R,10aS)-7-ethenyl-10-hydroxy-1,1,4a,7-tetramethyl-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthren-4-yl] acetate.
| Compound Name | [(4S,4aR,4bS,7R,10R,10aS)-7-ethenyl-10-hydroxy-1,1,4a,7-tetramethyl-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthren-4-yl] acetate |
|---|---|
| PubChem CID | 122397561 |
| Molecular Formula | C22H34O3 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | [(4S,4aR,4bS,7R,10R,10aS)-7-ethenyl-10-hydroxy-1,1,4a,7-tetramethyl-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthren-4-yl] acetate |
| SMILES | C=C[C@]1(C)C=C2C[C@@H](O)[C@H]3C(C)(C)CC[C@H](OC(C)=O)[C@]3(C)[C@H]2CC1 |
| InChI | InChI=1S/C22H34O3/c1-7-21(5)11-8-16-15(13-21)12-17(24)19-20(3,4)10-9-18(22(16,19)6)25-14(2)23/h7,13,16-19,24H,1,8-12H2,2-6H3/t16-,17+,18-,19-,21-,22-/m0/s1 |
| InChIKey | QSGRTRLHBQSTGZ-LXIBVNSESA-N |
| XLogP | 4.65 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|