C19H24O2 — CID 122398303
4-[[(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-5-prop-2-enylbenzene-1,2-diol (PubChem CID 122398303) has the molecular formula C19H24O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is 4-[[(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-5-prop-2-enylbenzene-1,2-diol.
| Compound Name | 4-[[(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-5-prop-2-enylbenzene-1,2-diol |
|---|---|
| PubChem CID | 122398303 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | 4-[[(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-5-prop-2-enylbenzene-1,2-diol |
| SMILES | C=CCc1cc(O)c(O)cc1CC1=CC[C@@H]2C[C@H]1C2(C)C |
| InChI | InChI=1S/C19H24O2/c1-4-5-12-9-17(20)18(21)10-14(12)8-13-6-7-15-11-16(13)19(15,2)3/h4,6,9-10,15-16,20-21H,1,5,7-8,11H2,2-3H3/t15-,16-/m1/s1 |
| InChIKey | MLPSFQKBDFGJAF-HZPDHXFCSA-N |
| XLogP | 4.36 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|