C13H19NO — CID 122398358
(2R,7S)-2,7-dimethyl-6-methylidene-4-azatricyclo[5.2.2.04,8]undecan-11-one (PubChem CID 122398358) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is (2R,7S)-2,7-dimethyl-6-methylidene-4-azatricyclo[5.2.2.04,8]undecan-11-one.
| Compound Name | (2R,7S)-2,7-dimethyl-6-methylidene-4-azatricyclo[5.2.2.04,8]undecan-11-one |
|---|---|
| PubChem CID | 122398358 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | (2R,7S)-2,7-dimethyl-6-methylidene-4-azatricyclo[5.2.2.04,8]undecan-11-one |
| SMILES | C=C1CN2C[C@H](C)C3CC(=O)[C@]1(C)C2C3 |
| InChI | InChI=1S/C13H19NO/c1-8-6-14-7-9(2)13(3)11(14)4-10(8)5-12(13)15/h8,10-11H,2,4-7H2,1,3H3/t8-,10?,11?,13-/m0/s1 |
| InChIKey | RZFMDGJKLASHAB-XAZOEFMPSA-N |
| XLogP | 1.86 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|