C21H28F2OSSi — CID 122399190
1,1-difluoro-1-phenylsulfanyl-3-[(1R,4S)-4-(4-trimethylsilylbut-3-ynyl)cyclopent-2-en-1-yl]propan-2-ol (PubChem CID 122399190) has the molecular formula C21H28F2OSSi and a molecular weight of 394.60 g/mol. Its IUPAC name is 1,1-difluoro-1-phenylsulfanyl-3-[(1R,4S)-4-(4-trimethylsilylbut-3-ynyl)cyclopent-2-en-1-yl]propan-2-ol.
| Compound Name | 1,1-difluoro-1-phenylsulfanyl-3-[(1R,4S)-4-(4-trimethylsilylbut-3-ynyl)cyclopent-2-en-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 122399190 |
| Molecular Formula | C21H28F2OSSi |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 1,1-difluoro-1-phenylsulfanyl-3-[(1R,4S)-4-(4-trimethylsilylbut-3-ynyl)cyclopent-2-en-1-yl]propan-2-ol |
| SMILES | C[Si](C)(C)C#CCC[C@@H]1C=C[C@@H](CC(O)C(F)(F)Sc2ccccc2)C1 |
| InChI | InChI=1S/C21H28F2OSSi/c1-26(2,3)14-8-7-9-17-12-13-18(15-17)16-20(24)21(22,23)25-19-10-5-4-6-11-19/h4-6,10-13,17-18,20,24H,7,9,15-16H2,1-3H3/t17-,18-,20?/m1/s1 |
| InChIKey | YIJLHSXCRRMBNF-KUBVQFIISA-N |
| XLogP | 5.98 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|