About 8-(4-bromophenyl)octa-5,7-diyn-1-ol
8-(4-bromophenyl)octa-5,7-diyn-1-ol (PubChem CID 122399225) has the molecular formula C14H13BrO
and a molecular weight of 277.16 g/mol. Its IUPAC name is 8-(4-bromophenyl)octa-5,7-diyn-1-ol.
Molecular Properties
| Compound Name | 8-(4-bromophenyl)octa-5,7-diyn-1-ol |
| PubChem CID | 122399225 |
| Molecular Formula | C14H13BrO |
| Molecular Weight | 277.16 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | 8-(4-bromophenyl)octa-5,7-diyn-1-ol |
| SMILES | OCCCCC#CC#Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C14H13BrO/c15-14-10-8-13(9-11-14)7-5-3-1-2-4-6-12-16/h8-11,16H,2,4,6,12H2 |
| InChIKey | ISSHILKLTFYWDW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.16 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-(4-bromophenyl)octa-5,7-diyn-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(4-bromophenyl)octa-5,7-diyn-1-ol?
The IUPAC name of 8-(4-bromophenyl)octa-5,7-diyn-1-ol (CID 122399225) is 8-(4-bromophenyl)octa-5,7-diyn-1-ol.
What is the SMILES notation for 8-(4-bromophenyl)octa-5,7-diyn-1-ol?
The canonical SMILES for 8-(4-bromophenyl)octa-5,7-diyn-1-ol is OCCCCC#CC#Cc1ccc(Br)cc1.
What is the InChIKey of 8-(4-bromophenyl)octa-5,7-diyn-1-ol?
The InChIKey is ISSHILKLTFYWDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13BrO/c15-14-10-8-13(9-11-14)7-5-3-1-2-4-6-12-16/h8-11,16H,2,4,6,12H2.
What are the key properties of 8-(4-bromophenyl)octa-5,7-diyn-1-ol?
8-(4-bromophenyl)octa-5,7-diyn-1-ol has a molecular weight of 277.16 g/mol, XLogP of 2.97, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(4-bromophenyl)octa-5,7-diyn-1-ol is sourced from PubChem (CID 122399225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).