C25H29N3 — CID 122399400
2,4,6-trimethyl-N-[[6-[(2,4,6-trimethylphenyl)iminomethyl]-2-pyridinyl]methyl]aniline (PubChem CID 122399400) has the molecular formula C25H29N3 and a molecular weight of 371.53 g/mol. Its IUPAC name is 2,4,6-trimethyl-N-[[6-[(2,4,6-trimethylphenyl)iminomethyl]-2-pyridinyl]methyl]aniline.
| Compound Name | 2,4,6-trimethyl-N-[[6-[(2,4,6-trimethylphenyl)iminomethyl]-2-pyridinyl]methyl]aniline |
|---|---|
| PubChem CID | 122399400 |
| Molecular Formula | C25H29N3 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.24 |
| IUPAC Name | 2,4,6-trimethyl-N-[[6-[(2,4,6-trimethylphenyl)iminomethyl]-2-pyridinyl]methyl]aniline |
| SMILES | Cc1cc(C)c(/N=C/c2cccc(CNc3c(C)cc(C)cc3C)n2)c(C)c1 |
| InChI | InChI=1S/C25H29N3/c1-16-10-18(3)24(19(4)11-16)26-14-22-8-7-9-23(28-22)15-27-25-20(5)12-17(2)13-21(25)6/h7-14,27H,15H2,1-6H3/b26-14+ |
| InChIKey | PJPPIQCKFGEMFB-VULFUBBASA-N |
| XLogP | 6.29 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|