C9H11F3O6 — CID 122399414
(1R,5R,6R,7S,8R,9S)-9-methoxy-6-(trifluoromethyl)-2,4,10-trioxatricyclo[3.3.1.13,7]decane-6,8-diol (PubChem CID 122399414) has the molecular formula C9H11F3O6 and a molecular weight of 272.18 g/mol. Its IUPAC name is (1R,5R,6R,7S,8R,9S)-9-methoxy-6-(trifluoromethyl)-2,4,10-trioxatricyclo[3.3.1.13,7]decane-6,8-diol.
| Compound Name | (1R,5R,6R,7S,8R,9S)-9-methoxy-6-(trifluoromethyl)-2,4,10-trioxatricyclo[3.3.1.13,7]decane-6,8-diol |
|---|---|
| PubChem CID | 122399414 |
| Molecular Formula | C9H11F3O6 |
| Molecular Weight | 272.18 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | (1R,5R,6R,7S,8R,9S)-9-methoxy-6-(trifluoromethyl)-2,4,10-trioxatricyclo[3.3.1.13,7]decane-6,8-diol |
| SMILES | CO[C@H]1[C@@H]2OC3O[C@H]1[C@@](O)(C(F)(F)F)[C@@H](O3)[C@@H]2O |
| InChI | InChI=1S/C9H11F3O6/c1-15-4-3-2(13)5-8(14,9(10,11)12)6(4)18-7(16-3)17-5/h2-7,13-14H,1H3/t2-,3-,4+,5+,6-,7?,8-/m1/s1 |
| InChIKey | HYGUQSWCEXJGCN-DYFRRQRXSA-N |
| XLogP | -0.86 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.18 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |