C25H29NO5 — CID 122399606
(1R,2R,6R,8S,9R,11R)-14-benzyl-4,4-dimethyl-9-phenylmethoxy-3,5,7,13-tetraoxa-14-azatetracyclo[6.6.0.01,11.02,6]tetradecane (PubChem CID 122399606) has the molecular formula C25H29NO5 and a molecular weight of 423.51 g/mol. Its IUPAC name is (1R,2R,6R,8S,9R,11R)-14-benzyl-4,4-dimethyl-9-phenylmethoxy-3,5,7,13-tetraoxa-14-azatetracyclo[6.6.0.01,11.02,6]tetradecane.
| Compound Name | (1R,2R,6R,8S,9R,11R)-14-benzyl-4,4-dimethyl-9-phenylmethoxy-3,5,7,13-tetraoxa-14-azatetracyclo[6.6.0.01,11.02,6]tetradecane |
|---|---|
| PubChem CID | 122399606 |
| Molecular Formula | C25H29NO5 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | (1R,2R,6R,8S,9R,11R)-14-benzyl-4,4-dimethyl-9-phenylmethoxy-3,5,7,13-tetraoxa-14-azatetracyclo[6.6.0.01,11.02,6]tetradecane |
| SMILES | CC1(C)O[C@H]2O[C@@H]3[C@H](OCc4ccccc4)C[C@H]4CON(Cc5ccccc5)[C@]43[C@H]2O1 |
| InChI | InChI=1S/C25H29NO5/c1-24(2)30-22-23(31-24)29-21-20(27-15-18-11-7-4-8-12-18)13-19-16-28-26(25(19,21)22)14-17-9-5-3-6-10-17/h3-12,19-23H,13-16H2,1-2H3/t19-,20+,21+,22-,23+,25+/m0/s1 |
| InChIKey | QSLRVPVSFBSYPE-SYQKRSDNSA-N |
| XLogP | 3.65 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |