C14H21NO3 — CID 122400035
(4aR,8S,8aR)-2-butyl-1-oxo-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxylic acid (PubChem CID 122400035) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is (4aR,8S,8aR)-2-butyl-1-oxo-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxylic acid.
| Compound Name | (4aR,8S,8aR)-2-butyl-1-oxo-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxylic acid |
|---|---|
| PubChem CID | 122400035 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | (4aR,8S,8aR)-2-butyl-1-oxo-3,4,4a,7,8,8a-hexahydroisoquinoline-8-carboxylic acid |
| SMILES | CCCCN1CC[C@@H]2C=CC[C@H](C(=O)O)[C@@H]2C1=O |
| InChI | InChI=1S/C14H21NO3/c1-2-3-8-15-9-7-10-5-4-6-11(14(17)18)12(10)13(15)16/h4-5,10-12H,2-3,6-9H2,1H3,(H,17,18)/t10-,11-,12+/m0/s1 |
| InChIKey | RONXMTGZSYOLGF-SDDRHHMPSA-N |
| XLogP | 1.91 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|