C31H22FNO3 — CID 122400117
(1R,8S,9S,13R)-11-(5-fluoro-2-methylphenyl)-1,8-diphenyl-14-oxa-11-azatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene-10,12-dione (PubChem CID 122400117) has the molecular formula C31H22FNO3 and a molecular weight of 475.52 g/mol. Its IUPAC name is (1R,8S,9S,13R)-11-(5-fluoro-2-methylphenyl)-1,8-diphenyl-14-oxa-11-azatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene-10,12-dione.
| Compound Name | (1R,8S,9S,13R)-11-(5-fluoro-2-methylphenyl)-1,8-diphenyl-14-oxa-11-azatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene-10,12-dione |
|---|---|
| PubChem CID | 122400117 |
| Molecular Formula | C31H22FNO3 |
| Molecular Weight | 475.52 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | (1R,8S,9S,13R)-11-(5-fluoro-2-methylphenyl)-1,8-diphenyl-14-oxa-11-azatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene-10,12-dione |
| SMILES | Cc1ccc(F)cc1N1C(=O)[C@@H]2[C@H](C1=O)[C@@]1(c3ccccc3)O[C@]2(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C31H22FNO3/c1-19-16-17-22(32)18-25(19)33-28(34)26-27(29(33)35)31(21-12-6-3-7-13-21)24-15-9-8-14-23(24)30(26,36-31)20-10-4-2-5-11-20/h2-18,26-27H,1H3/t26-,27+,30+,31- |
| InChIKey | UECDOIKVJBWLPM-AKAXLSRLSA-N |
| XLogP | 5.47 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.52 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|