C31H23NO3 — CID 122400121
(1S,8R,9R,13S)-11-(2-methylphenyl)-1,8-diphenyl-14-oxa-11-azatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene-10,12-dione (PubChem CID 122400121) has the molecular formula C31H23NO3 and a molecular weight of 457.53 g/mol. Its IUPAC name is (1S,8R,9R,13S)-11-(2-methylphenyl)-1,8-diphenyl-14-oxa-11-azatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene-10,12-dione.
| Compound Name | (1S,8R,9R,13S)-11-(2-methylphenyl)-1,8-diphenyl-14-oxa-11-azatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene-10,12-dione |
|---|---|
| PubChem CID | 122400121 |
| Molecular Formula | C31H23NO3 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | (1S,8R,9R,13S)-11-(2-methylphenyl)-1,8-diphenyl-14-oxa-11-azatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene-10,12-dione |
| SMILES | Cc1ccccc1N1C(=O)[C@@H]2[C@H](C1=O)[C@@]1(c3ccccc3)O[C@]2(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C31H23NO3/c1-20-12-8-11-19-25(20)32-28(33)26-27(29(32)34)31(22-15-6-3-7-16-22)24-18-10-9-17-23(24)30(26,35-31)21-13-4-2-5-14-21/h2-19,26-27H,1H3/t26-,27+,30+,31- |
| InChIKey | ITLSSJQRPFUSPN-AKAXLSRLSA-N |
| XLogP | 5.33 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|