C18H8Cl2I4 — CID 122400325
1,4-bis(4-chloro-2-iodophenyl)-2,5-diiodobenzene (PubChem CID 122400325) has the molecular formula C18H8Cl2I4 and a molecular weight of 802.78 g/mol. Its IUPAC name is 1,4-bis(4-chloro-2-iodophenyl)-2,5-diiodobenzene.
| Compound Name | 1,4-bis(4-chloro-2-iodophenyl)-2,5-diiodobenzene |
|---|---|
| PubChem CID | 122400325 |
| Molecular Formula | C18H8Cl2I4 |
| Molecular Weight | 802.78 g/mol |
| Exact Mass | 801.62 |
| IUPAC Name | 1,4-bis(4-chloro-2-iodophenyl)-2,5-diiodobenzene |
| SMILES | Clc1ccc(-c2cc(I)c(-c3ccc(Cl)cc3I)cc2I)c(I)c1 |
| InChI | InChI=1S/C18H8Cl2I4/c19-9-1-3-11(15(21)5-9)13-7-18(24)14(8-17(13)23)12-4-2-10(20)6-16(12)22/h1-8H |
| InChIKey | YRFNPKDGIWZGRC-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.78 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|