About 1,4-bis(4-chloro-2-iodophenyl)-2,5-diiodobenzene
1,4-bis(4-chloro-2-iodophenyl)-2,5-diiodobenzene (PubChem CID 122400325) has the molecular formula C18H8Cl2I4
and a molecular weight of 802.78 g/mol. Its IUPAC name is 1,4-bis(4-chloro-2-iodophenyl)-2,5-diiodobenzene.
Molecular Properties
| Compound Name | 1,4-bis(4-chloro-2-iodophenyl)-2,5-diiodobenzene |
| PubChem CID | 122400325 |
| Molecular Formula | C18H8Cl2I4 |
| Molecular Weight | 802.78 g/mol |
| Exact Mass | 801.62 |
| IUPAC Name | 1,4-bis(4-chloro-2-iodophenyl)-2,5-diiodobenzene |
| SMILES | Clc1ccc(-c2cc(I)c(-c3ccc(Cl)cc3I)cc2I)c(I)c1 |
| InChI | InChI=1S/C18H8Cl2I4/c19-9-1-3-11(15(21)5-9)13-7-18(24)14(8-17(13)23)12-4-2-10(20)6-16(12)22/h1-8H |
| InChIKey | YRFNPKDGIWZGRC-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 802.78 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1,4-bis(4-chloro-2-iodophenyl)-2,5-diiodobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-bis(4-chloro-2-iodophenyl)-2,5-diiodobenzene?
The IUPAC name of 1,4-bis(4-chloro-2-iodophenyl)-2,5-diiodobenzene (CID 122400325) is 1,4-bis(4-chloro-2-iodophenyl)-2,5-diiodobenzene.
What is the SMILES notation for 1,4-bis(4-chloro-2-iodophenyl)-2,5-diiodobenzene?
The canonical SMILES for 1,4-bis(4-chloro-2-iodophenyl)-2,5-diiodobenzene is Clc1ccc(-c2cc(I)c(-c3ccc(Cl)cc3I)cc2I)c(I)c1.
What is the InChIKey of 1,4-bis(4-chloro-2-iodophenyl)-2,5-diiodobenzene?
The InChIKey is YRFNPKDGIWZGRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H8Cl2I4/c19-9-1-3-11(15(21)5-9)13-7-18(24)14(8-17(13)23)12-4-2-10(20)6-16(12)22/h1-8H.
What are the key properties of 1,4-bis(4-chloro-2-iodophenyl)-2,5-diiodobenzene?
1,4-bis(4-chloro-2-iodophenyl)-2,5-diiodobenzene has a molecular weight of 802.78 g/mol, XLogP of 8.75, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-bis(4-chloro-2-iodophenyl)-2,5-diiodobenzene is sourced from PubChem (CID 122400325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).