C20H19NO4 — CID 122400338
methyl (7S,10R)-10-(furan-2-yl)-11-methyl-6-oxo-7,8,9,10-tetrahydroazepino[1,2-a]indole-7-carboxylate (PubChem CID 122400338) has the molecular formula C20H19NO4 and a molecular weight of 337.38 g/mol. Its IUPAC name is methyl (7S,10R)-10-(furan-2-yl)-11-methyl-6-oxo-7,8,9,10-tetrahydroazepino[1,2-a]indole-7-carboxylate.
| Compound Name | methyl (7S,10R)-10-(furan-2-yl)-11-methyl-6-oxo-7,8,9,10-tetrahydroazepino[1,2-a]indole-7-carboxylate |
|---|---|
| PubChem CID | 122400338 |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | methyl (7S,10R)-10-(furan-2-yl)-11-methyl-6-oxo-7,8,9,10-tetrahydroazepino[1,2-a]indole-7-carboxylate |
| SMILES | COC(=O)[C@H]1CC[C@@H](c2ccco2)c2c(C)c3ccccc3n2C1=O |
| InChI | InChI=1S/C20H19NO4/c1-12-13-6-3-4-7-16(13)21-18(12)14(17-8-5-11-25-17)9-10-15(19(21)22)20(23)24-2/h3-8,11,14-15H,9-10H2,1-2H3/t14-,15-/m0/s1 |
| InChIKey | QCYXCLQUEKVPPU-GJZGRUSLSA-N |
| XLogP | 3.90 |
| TPSA | 61.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|