About tert-butyl 2-ethenyl-4,4-bis(hydroxymethyl)thiolane-2-carboxylate
tert-butyl 2-ethenyl-4,4-bis(hydroxymethyl)thiolane-2-carboxylate (PubChem CID 122400401) has the molecular formula C13H22O4S
and a molecular weight of 274.38 g/mol. Its IUPAC name is tert-butyl 2-ethenyl-4,4-bis(hydroxymethyl)thiolane-2-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 2-ethenyl-4,4-bis(hydroxymethyl)thiolane-2-carboxylate |
| PubChem CID | 122400401 |
| Molecular Formula | C13H22O4S |
| Molecular Weight | 274.38 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | tert-butyl 2-ethenyl-4,4-bis(hydroxymethyl)thiolane-2-carboxylate |
| SMILES | C=CC1(C(=O)OC(C)(C)C)CC(CO)(CO)CS1 |
| InChI | InChI=1S/C13H22O4S/c1-5-13(10(16)17-11(2,3)4)6-12(7-14,8-15)9-18-13/h5,14-15H,1,6-9H2,2-4H3 |
| InChIKey | NTJJFMOWJNLBBQ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.38 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-ethenyl-4,4-bis(hydroxymethyl)thiolane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-ethenyl-4,4-bis(hydroxymethyl)thiolane-2-carboxylate?
The IUPAC name of tert-butyl 2-ethenyl-4,4-bis(hydroxymethyl)thiolane-2-carboxylate (CID 122400401) is tert-butyl 2-ethenyl-4,4-bis(hydroxymethyl)thiolane-2-carboxylate.
What is the SMILES notation for tert-butyl 2-ethenyl-4,4-bis(hydroxymethyl)thiolane-2-carboxylate?
The canonical SMILES for tert-butyl 2-ethenyl-4,4-bis(hydroxymethyl)thiolane-2-carboxylate is C=CC1(C(=O)OC(C)(C)C)CC(CO)(CO)CS1.
What is the InChIKey of tert-butyl 2-ethenyl-4,4-bis(hydroxymethyl)thiolane-2-carboxylate?
The InChIKey is NTJJFMOWJNLBBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O4S/c1-5-13(10(16)17-11(2,3)4)6-12(7-14,8-15)9-18-13/h5,14-15H,1,6-9H2,2-4H3.
What are the key properties of tert-butyl 2-ethenyl-4,4-bis(hydroxymethyl)thiolane-2-carboxylate?
tert-butyl 2-ethenyl-4,4-bis(hydroxymethyl)thiolane-2-carboxylate has a molecular weight of 274.38 g/mol, XLogP of 1.36, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-ethenyl-4,4-bis(hydroxymethyl)thiolane-2-carboxylate is sourced from PubChem (CID 122400401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).