C21H24N2O2 — CID 122400449
N-[(7R,8R,8aS,10aR)-7-ethenyl-8-isocyano-7,10,10-trimethyl-9-oxo-6,8,8a,10a-tetrahydro-5H-anthracen-1-yl]formamide (PubChem CID 122400449) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is N-[(7R,8R,8aS,10aR)-7-ethenyl-8-isocyano-7,10,10-trimethyl-9-oxo-6,8,8a,10a-tetrahydro-5H-anthracen-1-yl]formamide.
| Compound Name | N-[(7R,8R,8aS,10aR)-7-ethenyl-8-isocyano-7,10,10-trimethyl-9-oxo-6,8,8a,10a-tetrahydro-5H-anthracen-1-yl]formamide |
|---|---|
| PubChem CID | 122400449 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | N-[(7R,8R,8aS,10aR)-7-ethenyl-8-isocyano-7,10,10-trimethyl-9-oxo-6,8,8a,10a-tetrahydro-5H-anthracen-1-yl]formamide |
| SMILES | [C-]#[N+][C@@H]1[C@H]2C(=O)c3c(NC=O)cccc3C(C)(C)[C@@H]2CC[C@]1(C)C=C |
| InChI | InChI=1S/C21H24N2O2/c1-6-21(4)11-10-14-17(19(21)22-5)18(25)16-13(20(14,2)3)8-7-9-15(16)23-12-24/h6-9,12,14,17,19H,1,10-11H2,2-4H3,(H,23,24)/t14-,17-,19-,21+/m1/s1 |
| InChIKey | JECFIXMTIIOGJS-QTRJSKNGSA-N |
| XLogP | 4.24 |
| TPSA | 50.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|