C26H24F2N2O2 — CID 122400799
2,2-difluoroethyl 3-methyl-2-(13-methyl-1,9-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaen-5-yl)benzoate (PubChem CID 122400799) has the molecular formula C26H24F2N2O2 and a molecular weight of 434.49 g/mol. Its IUPAC name is 2,2-difluoroethyl 3-methyl-2-(13-methyl-1,9-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaen-5-yl)benzoate.
| Compound Name | 2,2-difluoroethyl 3-methyl-2-(13-methyl-1,9-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaen-5-yl)benzoate |
|---|---|
| PubChem CID | 122400799 |
| Molecular Formula | C26H24F2N2O2 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 2,2-difluoroethyl 3-methyl-2-(13-methyl-1,9-diazatetracyclo[7.7.1.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaen-5-yl)benzoate |
| SMILES | Cc1ccc2c(c1)CN1CN2Cc2cc(-c3c(C)cccc3C(=O)OCC(F)F)ccc21 |
| InChI | InChI=1S/C26H24F2N2O2/c1-16-6-8-22-19(10-16)12-29-15-30(22)13-20-11-18(7-9-23(20)29)25-17(2)4-3-5-21(25)26(31)32-14-24(27)28/h3-11,24H,12-15H2,1-2H3 |
| InChIKey | ONKPZEZVZHOELW-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |