C20H17NO3 — CID 122401334
methyl 2-(2-methyl-4,5-diphenyl-1H-pyrrol-3-yl)-2-oxoacetate (PubChem CID 122401334) has the molecular formula C20H17NO3 and a molecular weight of 319.36 g/mol. Its IUPAC name is methyl 2-(2-methyl-4,5-diphenyl-1H-pyrrol-3-yl)-2-oxoacetate.
| Compound Name | methyl 2-(2-methyl-4,5-diphenyl-1H-pyrrol-3-yl)-2-oxoacetate |
|---|---|
| PubChem CID | 122401334 |
| Molecular Formula | C20H17NO3 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | methyl 2-(2-methyl-4,5-diphenyl-1H-pyrrol-3-yl)-2-oxoacetate |
| SMILES | COC(=O)C(=O)c1c(C)[nH]c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C20H17NO3/c1-13-16(19(22)20(23)24-2)17(14-9-5-3-6-10-14)18(21-13)15-11-7-4-8-12-15/h3-12,21H,1-2H3 |
| InChIKey | DJETXZCIAVNGCB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|