C18H19NO3 — CID 122401712
ethyl (4aR,4bR,10R,10aS)-10-cyano-2-oxo-1,3,4,4a,4b,10a-hexahydrobenzo[a]azulene-10-carboxylate (PubChem CID 122401712) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is ethyl (4aR,4bR,10R,10aS)-10-cyano-2-oxo-1,3,4,4a,4b,10a-hexahydrobenzo[a]azulene-10-carboxylate.
| Compound Name | ethyl (4aR,4bR,10R,10aS)-10-cyano-2-oxo-1,3,4,4a,4b,10a-hexahydrobenzo[a]azulene-10-carboxylate |
|---|---|
| PubChem CID | 122401712 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | ethyl (4aR,4bR,10R,10aS)-10-cyano-2-oxo-1,3,4,4a,4b,10a-hexahydrobenzo[a]azulene-10-carboxylate |
| SMILES | CCOC(=O)[C@@]1(C#N)C2=CC=CC=C[C@@H]2[C@@H]2CCC(=O)C[C@@H]21 |
| InChI | InChI=1S/C18H19NO3/c1-2-22-17(21)18(11-19)15-7-5-3-4-6-13(15)14-9-8-12(20)10-16(14)18/h3-7,13-14,16H,2,8-10H2,1H3/t13-,14+,16+,18+/m1/s1 |
| InChIKey | XHDAIMOHBVJCAL-OAOQPFQOSA-N |
| XLogP | 2.73 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |