C21H29NOSi — CID 122401994
(2S)-1-benzyl-2-[(1R)-1-trimethylsilylethyl]-2,6,7,8-tetrahydroquinolin-5-one (PubChem CID 122401994) has the molecular formula C21H29NOSi and a molecular weight of 339.55 g/mol. Its IUPAC name is (2S)-1-benzyl-2-[(1R)-1-trimethylsilylethyl]-2,6,7,8-tetrahydroquinolin-5-one.
| Compound Name | (2S)-1-benzyl-2-[(1R)-1-trimethylsilylethyl]-2,6,7,8-tetrahydroquinolin-5-one |
|---|---|
| PubChem CID | 122401994 |
| Molecular Formula | C21H29NOSi |
| Molecular Weight | 339.55 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | (2S)-1-benzyl-2-[(1R)-1-trimethylsilylethyl]-2,6,7,8-tetrahydroquinolin-5-one |
| SMILES | C[C@H]([C@@H]1C=CC2=C(CCCC2=O)N1Cc1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C21H29NOSi/c1-16(24(2,3)4)19-14-13-18-20(11-8-12-21(18)23)22(19)15-17-9-6-5-7-10-17/h5-7,9-10,13-14,16,19H,8,11-12,15H2,1-4H3/t16-,19+/m1/s1 |
| InChIKey | CZBLYWFQHIHBOA-APWZRJJASA-N |
| XLogP | 5.16 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.55 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|