About 2-bromo-6-chloro-3,4-difluoroaniline
2-bromo-6-chloro-3,4-difluoroaniline (PubChem CID 122402925) has the molecular formula C6H3BrClF2N
and a molecular weight of 242.45 g/mol. Its IUPAC name is 2-bromo-6-chloro-3,4-difluoroaniline.
Molecular Properties
| Compound Name | 2-bromo-6-chloro-3,4-difluoroaniline |
| PubChem CID | 122402925 |
| Molecular Formula | C6H3BrClF2N |
| Molecular Weight | 242.45 g/mol |
| Exact Mass | 240.91 |
| IUPAC Name | 2-bromo-6-chloro-3,4-difluoroaniline |
| SMILES | Nc1c(Cl)cc(F)c(F)c1Br |
| InChI | InChI=1S/C6H3BrClF2N/c7-4-5(10)3(9)1-2(8)6(4)11/h1H,11H2 |
| InChIKey | WRYYSTBXABTPQN-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.45 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-6-chloro-3,4-difluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-6-chloro-3,4-difluoroaniline?
The IUPAC name of 2-bromo-6-chloro-3,4-difluoroaniline (CID 122402925) is 2-bromo-6-chloro-3,4-difluoroaniline.
What is the SMILES notation for 2-bromo-6-chloro-3,4-difluoroaniline?
The canonical SMILES for 2-bromo-6-chloro-3,4-difluoroaniline is Nc1c(Cl)cc(F)c(F)c1Br.
What is the InChIKey of 2-bromo-6-chloro-3,4-difluoroaniline?
The InChIKey is WRYYSTBXABTPQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3BrClF2N/c7-4-5(10)3(9)1-2(8)6(4)11/h1H,11H2.
What are the key properties of 2-bromo-6-chloro-3,4-difluoroaniline?
2-bromo-6-chloro-3,4-difluoroaniline has a molecular weight of 242.45 g/mol, XLogP of 2.96, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-6-chloro-3,4-difluoroaniline is sourced from PubChem (CID 122402925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).