C14H19ClO2 — CID 122403035
9-oxo-1,2,3,4,4a,4b,5,6,7,8,8a,9a-dodecahydrofluorene-1-carbonyl chloride (PubChem CID 122403035) has the molecular formula C14H19ClO2 and a molecular weight of 254.76 g/mol. Its IUPAC name is 9-oxo-1,2,3,4,4a,4b,5,6,7,8,8a,9a-dodecahydrofluorene-1-carbonyl chloride.
| Compound Name | 9-oxo-1,2,3,4,4a,4b,5,6,7,8,8a,9a-dodecahydrofluorene-1-carbonyl chloride |
|---|---|
| PubChem CID | 122403035 |
| Molecular Formula | C14H19ClO2 |
| Molecular Weight | 254.76 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 9-oxo-1,2,3,4,4a,4b,5,6,7,8,8a,9a-dodecahydrofluorene-1-carbonyl chloride |
| SMILES | O=C(Cl)C1CCCC2C3CCCCC3C(=O)C12 |
| InChI | InChI=1S/C14H19ClO2/c15-14(17)11-7-3-6-9-8-4-1-2-5-10(8)13(16)12(9)11/h8-12H,1-7H2 |
| InChIKey | VBKQXHHKJSJZEE-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.76 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|