C14H17NO2 — CID 122403145
2'-methoxyspiro[cyclohexane-1,3'-isoindole]-1'-one (PubChem CID 122403145) has the molecular formula C14H17NO2 and a molecular weight of 231.30 g/mol. Its IUPAC name is 2'-methoxyspiro[cyclohexane-1,3'-isoindole]-1'-one.
| Compound Name | 2'-methoxyspiro[cyclohexane-1,3'-isoindole]-1'-one |
|---|---|
| PubChem CID | 122403145 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 2'-methoxyspiro[cyclohexane-1,3'-isoindole]-1'-one |
| SMILES | CON1C(=O)c2ccccc2C12CCCCC2 |
| InChI | InChI=1S/C14H17NO2/c1-17-15-13(16)11-7-3-4-8-12(11)14(15)9-5-2-6-10-14/h3-4,7-8H,2,5-6,9-10H2,1H3 |
| InChIKey | FPJYASQPWDEATL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |