C54H97NO12 — CID 122403372
4-O-[(2R)-2,3-bis[[(Z)-octadec-9-enoyl]oxy]propyl] 1-O-[2-[2-[2-[3-(dimethylamino)propanoyloxy]ethoxy]ethoxy]ethyl] butanedioate (PubChem CID 122403372) has the molecular formula C54H97NO12 and a molecular weight of 952.36 g/mol. Its IUPAC name is 4-O-[(2R)-2,3-bis[[(Z)-octadec-9-enoyl]oxy]propyl] 1-O-[2-[2-[2-[3-(dimethylamino)propanoyloxy]ethoxy]ethoxy]ethyl] butanedioate.
| Compound Name | 4-O-[(2R)-2,3-bis[[(Z)-octadec-9-enoyl]oxy]propyl] 1-O-[2-[2-[2-[3-(dimethylamino)propanoyloxy]ethoxy]ethoxy]ethyl] butanedioate |
|---|---|
| PubChem CID | 122403372 |
| Molecular Formula | C54H97NO12 |
| Molecular Weight | 952.36 g/mol |
| Exact Mass | 951.70 |
| IUPAC Name | 4-O-[(2R)-2,3-bis[[(Z)-octadec-9-enoyl]oxy]propyl] 1-O-[2-[2-[2-[3-(dimethylamino)propanoyloxy]ethoxy]ethoxy]ethyl] butanedioate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@H](COC(=O)CCC(=O)OCCOCCOCCOC(=O)CCN(C)C)OC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C54H97NO12/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-50(56)65-47-49(67-54(60)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2)48-66-52(58)38-37-51(57)63-45-43-61-41-42-62-44-46-64-53(59)39-40-55(3)4/h19-22,49H,5-18,23-48H2,1-4H3/b21-19-,22-20-/t49-/m1/s1 |
| InChIKey | WLXUFFQOCAVDPR-QFAUJDCOSA-N |
| XLogP | 11.91 |
| TPSA | 153.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 50 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 952.36 |
| LogP ≤ 5 | 11.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|