C16H30O4 — CID 122403487
(2R,3R,7S,8E)-3-methoxy-2-(methoxymethoxy)-7,9-dimethylundeca-8,10-dien-1-ol (PubChem CID 122403487) has the molecular formula C16H30O4 and a molecular weight of 286.41 g/mol. Its IUPAC name is (2R,3R,7S,8E)-3-methoxy-2-(methoxymethoxy)-7,9-dimethylundeca-8,10-dien-1-ol.
| Compound Name | (2R,3R,7S,8E)-3-methoxy-2-(methoxymethoxy)-7,9-dimethylundeca-8,10-dien-1-ol |
|---|---|
| PubChem CID | 122403487 |
| Molecular Formula | C16H30O4 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | (2R,3R,7S,8E)-3-methoxy-2-(methoxymethoxy)-7,9-dimethylundeca-8,10-dien-1-ol |
| SMILES | C=C/C(C)=C/[C@@H](C)CCC[C@@H](OC)[C@@H](CO)OCOC |
| InChI | InChI=1S/C16H30O4/c1-6-13(2)10-14(3)8-7-9-15(19-5)16(11-17)20-12-18-4/h6,10,14-17H,1,7-9,11-12H2,2-5H3/b13-10+/t14-,15+,16+/m0/s1 |
| InChIKey | VDMRNROVJOLQSZ-VDHMTLRISA-N |
| XLogP | 2.92 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|