C10H9BrClNO — CID 122403574
5-(bromomethyl)-2-(4-chlorophenyl)-4,5-dihydro-1,3-oxazole (PubChem CID 122403574) has the molecular formula C10H9BrClNO and a molecular weight of 274.55 g/mol. Its IUPAC name is 5-(bromomethyl)-2-(4-chlorophenyl)-4,5-dihydro-1,3-oxazole.
| Compound Name | 5-(bromomethyl)-2-(4-chlorophenyl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 122403574 |
| Molecular Formula | C10H9BrClNO |
| Molecular Weight | 274.55 g/mol |
| Exact Mass | 272.96 |
| IUPAC Name | 5-(bromomethyl)-2-(4-chlorophenyl)-4,5-dihydro-1,3-oxazole |
| SMILES | Clc1ccc(C2=NCC(CBr)O2)cc1 |
| InChI | InChI=1S/C10H9BrClNO/c11-5-9-6-13-10(14-9)7-1-3-8(12)4-2-7/h1-4,9H,5-6H2 |
| InChIKey | RNFKYAARQZBKQB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.55 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|