C33H34N2O4 — CID 122403823
[(2R,3S)-1-(cyclohexylamino)-1-oxo-3-phenyl-3-[[(E)-3-phenylprop-2-enoyl]amino]propan-2-yl] (E)-3-phenylprop-2-enoate (PubChem CID 122403823) has the molecular formula C33H34N2O4 and a molecular weight of 522.65 g/mol. Its IUPAC name is [(2R,3S)-1-(cyclohexylamino)-1-oxo-3-phenyl-3-[[(E)-3-phenylprop-2-enoyl]amino]propan-2-yl] (E)-3-phenylprop-2-enoate.
| Compound Name | [(2R,3S)-1-(cyclohexylamino)-1-oxo-3-phenyl-3-[[(E)-3-phenylprop-2-enoyl]amino]propan-2-yl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 122403823 |
| Molecular Formula | C33H34N2O4 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.25 |
| IUPAC Name | [(2R,3S)-1-(cyclohexylamino)-1-oxo-3-phenyl-3-[[(E)-3-phenylprop-2-enoyl]amino]propan-2-yl] (E)-3-phenylprop-2-enoate |
| SMILES | O=C(/C=C/c1ccccc1)N[C@@H](c1ccccc1)[C@@H](OC(=O)/C=C/c1ccccc1)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C33H34N2O4/c36-29(23-21-25-13-5-1-6-14-25)35-31(27-17-9-3-10-18-27)32(33(38)34-28-19-11-4-12-20-28)39-30(37)24-22-26-15-7-2-8-16-26/h1-3,5-10,13-18,21-24,28,31-32H,4,11-12,19-20H2,(H,34,38)(H,35,36)/b23-21+,24-22+/t31-,32+/m0/s1 |
| InChIKey | VMNLLJVJGPUQPT-UTZBLQDVSA-N |
| XLogP | 5.63 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|