C42H50O8 — CID 122404250
6-butyl-1-[4-[6-butyl-2,3-bis(methoxymethoxy)naphthalen-1-yl]phenyl]-2,3-bis(methoxymethoxy)naphthalene (PubChem CID 122404250) has the molecular formula C42H50O8 and a molecular weight of 682.85 g/mol. Its IUPAC name is 6-butyl-1-[4-[6-butyl-2,3-bis(methoxymethoxy)naphthalen-1-yl]phenyl]-2,3-bis(methoxymethoxy)naphthalene.
| Compound Name | 6-butyl-1-[4-[6-butyl-2,3-bis(methoxymethoxy)naphthalen-1-yl]phenyl]-2,3-bis(methoxymethoxy)naphthalene |
|---|---|
| PubChem CID | 122404250 |
| Molecular Formula | C42H50O8 |
| Molecular Weight | 682.85 g/mol |
| Exact Mass | 682.35 |
| IUPAC Name | 6-butyl-1-[4-[6-butyl-2,3-bis(methoxymethoxy)naphthalen-1-yl]phenyl]-2,3-bis(methoxymethoxy)naphthalene |
| SMILES | CCCCc1ccc2c(-c3ccc(-c4c(OCOC)c(OCOC)cc5cc(CCCC)ccc45)cc3)c(OCOC)c(OCOC)cc2c1 |
| InChI | InChI=1S/C42H50O8/c1-7-9-11-29-13-19-35-33(21-29)23-37(47-25-43-3)41(49-27-45-5)39(35)31-15-17-32(18-16-31)40-36-20-14-30(12-10-8-2)22-34(36)24-38(48-26-44-4)42(40)50-28-46-6/h13-24H,7-12,25-28H2,1-6H3 |
| InChIKey | WZZUEGKFZUNIRC-UHFFFAOYSA-N |
| XLogP | 9.94 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.85 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|