C20H30O4 — CID 122407397
(Z,2S,3R)-3-acetyl-2-[(E)-2-(6-oxooxan-2-yl)ethenyl]undec-5-enal (PubChem CID 122407397) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is (Z,2S,3R)-3-acetyl-2-[(E)-2-(6-oxooxan-2-yl)ethenyl]undec-5-enal.
| Compound Name | (Z,2S,3R)-3-acetyl-2-[(E)-2-(6-oxooxan-2-yl)ethenyl]undec-5-enal |
|---|---|
| PubChem CID | 122407397 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (Z,2S,3R)-3-acetyl-2-[(E)-2-(6-oxooxan-2-yl)ethenyl]undec-5-enal |
| SMILES | CCCCC/C=C\CC(C(C)=O)[C@@H](C=O)/C=C/C1CCCC(=O)O1 |
| InChI | InChI=1S/C20H30O4/c1-3-4-5-6-7-8-11-19(16(2)22)17(15-21)13-14-18-10-9-12-20(23)24-18/h7-8,13-15,17-19H,3-6,9-12H2,1-2H3/b8-7-,14-13+/t17-,18?,19?/m1/s1 |
| InChIKey | XPKFNWBZPJUGJV-BBFLWXSMSA-N |
| XLogP | 4.19 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|