About 3-phenylspiro[azirine-2,9'-fluorene]
3-phenylspiro[azirine-2,9'-fluorene] (PubChem CID 1224108) has the molecular formula C20H13N
and a molecular weight of 267.33 g/mol. Its IUPAC name is 3-phenylspiro[azirine-2,9'-fluorene].
Molecular Properties
| Compound Name | 3-phenylspiro[azirine-2,9'-fluorene] |
| PubChem CID | 1224108 |
| Molecular Formula | C20H13N |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 3-phenylspiro[azirine-2,9'-fluorene] |
| SMILES | c1ccc(C2=NC23c2ccccc2-c2ccccc23)cc1 |
| InChI | InChI=1S/C20H13N/c1-2-8-14(9-3-1)19-20(21-19)17-12-6-4-10-15(17)16-11-5-7-13-18(16)20/h1-13H |
| InChIKey | BOLIYAAGEVQMLU-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-phenylspiro[azirine-2,9'-fluorene] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylspiro[azirine-2,9'-fluorene]?
The IUPAC name of 3-phenylspiro[azirine-2,9'-fluorene] (CID 1224108) is 3-phenylspiro[azirine-2,9'-fluorene].
What is the SMILES notation for 3-phenylspiro[azirine-2,9'-fluorene]?
The canonical SMILES for 3-phenylspiro[azirine-2,9'-fluorene] is c1ccc(C2=NC23c2ccccc2-c2ccccc23)cc1.
What is the InChIKey of 3-phenylspiro[azirine-2,9'-fluorene]?
The InChIKey is BOLIYAAGEVQMLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13N/c1-2-8-14(9-3-1)19-20(21-19)17-12-6-4-10-15(17)16-11-5-7-13-18(16)20/h1-13H.
What are the key properties of 3-phenylspiro[azirine-2,9'-fluorene]?
3-phenylspiro[azirine-2,9'-fluorene] has a molecular weight of 267.33 g/mol, XLogP of 4.41, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylspiro[azirine-2,9'-fluorene] is sourced from PubChem (CID 1224108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).