C29H47NO3Sn — CID 122411848
(3E,5S)-3-[(2E,4E,6E,8E)-1-hydroxy-9-tributylstannylnona-2,4,6,8-tetraenylidene]-1-methyl-5-propan-2-ylpyrrolidine-2,4-dione (PubChem CID 122411848) has the molecular formula C29H47NO3Sn and a molecular weight of 576.41 g/mol. Its IUPAC name is (3E,5S)-3-[(2E,4E,6E,8E)-1-hydroxy-9-tributylstannylnona-2,4,6,8-tetraenylidene]-1-methyl-5-propan-2-ylpyrrolidine-2,4-dione.
| Compound Name | (3E,5S)-3-[(2E,4E,6E,8E)-1-hydroxy-9-tributylstannylnona-2,4,6,8-tetraenylidene]-1-methyl-5-propan-2-ylpyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 122411848 |
| Molecular Formula | C29H47NO3Sn |
| Molecular Weight | 576.41 g/mol |
| Exact Mass | 577.26 |
| IUPAC Name | (3E,5S)-3-[(2E,4E,6E,8E)-1-hydroxy-9-tributylstannylnona-2,4,6,8-tetraenylidene]-1-methyl-5-propan-2-ylpyrrolidine-2,4-dione |
| SMILES | CCCC[Sn](/C=C/C=C/C=C/C=C/C(O)=C1/C(=O)[C@H](C(C)C)N(C)C1=O)(CCCC)CCCC |
| InChI | InChI=1S/C17H20NO3.3C4H9.Sn/c1-5-6-7-8-9-10-11-13(19)14-16(20)15(12(2)3)18(4)17(14)21;3*1-3-4-2;/h1,5-12,15,19H,2-4H3;3*1,3-4H2,2H3;/b5-1?,7-6+,9-8+,11-10+,14-13+;;;;/t15-;;;;/m0..../s1 |
| InChIKey | JITAKBRFGIEDDU-NDEUEUOBSA-N |
| XLogP | 7.48 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.41 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|