C24H30N2O3S — CID 122413473
N,N-dimethyl-4-[6-[(2S)-2-(oxan-2-yloxy)butoxy]-1,3-benzothiazol-2-yl]aniline (PubChem CID 122413473) has the molecular formula C24H30N2O3S and a molecular weight of 426.58 g/mol. Its IUPAC name is N,N-dimethyl-4-[6-[(2S)-2-(oxan-2-yloxy)butoxy]-1,3-benzothiazol-2-yl]aniline.
| Compound Name | N,N-dimethyl-4-[6-[(2S)-2-(oxan-2-yloxy)butoxy]-1,3-benzothiazol-2-yl]aniline |
|---|---|
| PubChem CID | 122413473 |
| Molecular Formula | C24H30N2O3S |
| Molecular Weight | 426.58 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | N,N-dimethyl-4-[6-[(2S)-2-(oxan-2-yloxy)butoxy]-1,3-benzothiazol-2-yl]aniline |
| SMILES | CC[C@@H](COc1ccc2nc(-c3ccc(N(C)C)cc3)sc2c1)OC1CCCCO1 |
| InChI | InChI=1S/C24H30N2O3S/c1-4-19(29-23-7-5-6-14-27-23)16-28-20-12-13-21-22(15-20)30-24(25-21)17-8-10-18(11-9-17)26(2)3/h8-13,15,19,23H,4-7,14,16H2,1-3H3/t19-,23?/m0/s1 |
| InChIKey | VHMMUWIUHARRHC-HSTJUUNISA-N |
| XLogP | 5.73 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.58 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|