C19H14F4O3S — CID 122413488
1-(4-methylphenyl)-4-(2,2,3,3-tetrafluoro-1,4-benzoxathiin-7-yl)butane-1,4-dione (PubChem CID 122413488) has the molecular formula C19H14F4O3S and a molecular weight of 398.38 g/mol. Its IUPAC name is 1-(4-methylphenyl)-4-(2,2,3,3-tetrafluoro-1,4-benzoxathiin-7-yl)butane-1,4-dione.
| Compound Name | 1-(4-methylphenyl)-4-(2,2,3,3-tetrafluoro-1,4-benzoxathiin-7-yl)butane-1,4-dione |
|---|---|
| PubChem CID | 122413488 |
| Molecular Formula | C19H14F4O3S |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | 1-(4-methylphenyl)-4-(2,2,3,3-tetrafluoro-1,4-benzoxathiin-7-yl)butane-1,4-dione |
| SMILES | Cc1ccc(C(=O)CCC(=O)c2ccc3c(c2)OC(F)(F)C(F)(F)S3)cc1 |
| InChI | InChI=1S/C19H14F4O3S/c1-11-2-4-12(5-3-11)14(24)7-8-15(25)13-6-9-17-16(10-13)26-18(20,21)19(22,23)27-17/h2-6,9-10H,7-8H2,1H3 |
| InChIKey | ULRXZKQDVCUSNQ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|