C30H28N2O5 — CID 122413576
1-[4-[1,1-bis(4-hydroxyphenyl)-3-oxoisoindol-2-yl]-2,3-dimethylbutyl]pyrrole-2,5-dione (PubChem CID 122413576) has the molecular formula C30H28N2O5 and a molecular weight of 496.56 g/mol. Its IUPAC name is 1-[4-[1,1-bis(4-hydroxyphenyl)-3-oxoisoindol-2-yl]-2,3-dimethylbutyl]pyrrole-2,5-dione.
| Compound Name | 1-[4-[1,1-bis(4-hydroxyphenyl)-3-oxoisoindol-2-yl]-2,3-dimethylbutyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 122413576 |
| Molecular Formula | C30H28N2O5 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | 1-[4-[1,1-bis(4-hydroxyphenyl)-3-oxoisoindol-2-yl]-2,3-dimethylbutyl]pyrrole-2,5-dione |
| SMILES | CC(CN1C(=O)C=CC1=O)C(C)CN1C(=O)c2ccccc2C1(c1ccc(O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C30H28N2O5/c1-19(17-31-27(35)15-16-28(31)36)20(2)18-32-29(37)25-5-3-4-6-26(25)30(32,21-7-11-23(33)12-8-21)22-9-13-24(34)14-10-22/h3-16,19-20,33-34H,17-18H2,1-2H3 |
| InChIKey | NDGXZVRMACQLQQ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|