C15H26O4 — CID 122413906
(E,9R,10S)-10-acetyloxy-9-methyldodec-6-enoic acid (PubChem CID 122413906) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is (E,9R,10S)-10-acetyloxy-9-methyldodec-6-enoic acid.
| Compound Name | (E,9R,10S)-10-acetyloxy-9-methyldodec-6-enoic acid |
|---|---|
| PubChem CID | 122413906 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | (E,9R,10S)-10-acetyloxy-9-methyldodec-6-enoic acid |
| SMILES | CC[C@H](OC(C)=O)[C@H](C)C/C=C/CCCCC(=O)O |
| InChI | InChI=1S/C15H26O4/c1-4-14(19-13(3)16)12(2)10-8-6-5-7-9-11-15(17)18/h6,8,12,14H,4-5,7,9-11H2,1-3H3,(H,17,18)/b8-6+/t12-,14+/m1/s1 |
| InChIKey | QIABSIVUORFSSY-AGMJWKPSSA-N |
| XLogP | 3.56 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|