About 9-tert-butyl-2-methyl-4,5-dihydro-1H-purin-6-one
9-tert-butyl-2-methyl-4,5-dihydro-1H-purin-6-one (PubChem CID 122413980) has the molecular formula C10H16N4O
and a molecular weight of 208.26 g/mol. Its IUPAC name is 9-tert-butyl-2-methyl-4,5-dihydro-1H-purin-6-one.
Molecular Properties
| Compound Name | 9-tert-butyl-2-methyl-4,5-dihydro-1H-purin-6-one |
| PubChem CID | 122413980 |
| Molecular Formula | C10H16N4O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 9-tert-butyl-2-methyl-4,5-dihydro-1H-purin-6-one |
| SMILES | CC1=NC2C(N=CN2C(C)(C)C)C(=O)N1 |
| InChI | InChI=1S/C10H16N4O/c1-6-12-8-7(9(15)13-6)11-5-14(8)10(2,3)4/h5,7-8H,1-4H3,(H,12,13,15) |
| InChIKey | LEIBYKPUNUDHCP-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 57.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-tert-butyl-2-methyl-4,5-dihydro-1H-purin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-tert-butyl-2-methyl-4,5-dihydro-1H-purin-6-one?
The IUPAC name of 9-tert-butyl-2-methyl-4,5-dihydro-1H-purin-6-one (CID 122413980) is 9-tert-butyl-2-methyl-4,5-dihydro-1H-purin-6-one.
What is the SMILES notation for 9-tert-butyl-2-methyl-4,5-dihydro-1H-purin-6-one?
The canonical SMILES for 9-tert-butyl-2-methyl-4,5-dihydro-1H-purin-6-one is CC1=NC2C(N=CN2C(C)(C)C)C(=O)N1.
What is the InChIKey of 9-tert-butyl-2-methyl-4,5-dihydro-1H-purin-6-one?
The InChIKey is LEIBYKPUNUDHCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4O/c1-6-12-8-7(9(15)13-6)11-5-14(8)10(2,3)4/h5,7-8H,1-4H3,(H,12,13,15).
What are the key properties of 9-tert-butyl-2-methyl-4,5-dihydro-1H-purin-6-one?
9-tert-butyl-2-methyl-4,5-dihydro-1H-purin-6-one has a molecular weight of 208.26 g/mol, XLogP of 0.37, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-tert-butyl-2-methyl-4,5-dihydro-1H-purin-6-one is sourced from PubChem (CID 122413980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).