About (E)-3-[3-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]-1H-pyrazol-5-yl]-1-phenylprop-2-en-1-one
(E)-3-[3-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]-1H-pyrazol-5-yl]-1-phenylprop-2-en-1-one (PubChem CID 122414064) has the molecular formula C21H20N2O4
and a molecular weight of 364.40 g/mol. Its IUPAC name is (E)-3-[3-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]-1H-pyrazol-5-yl]-1-phenylprop-2-en-1-one.
Molecular Properties
| Compound Name | (E)-3-[3-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]-1H-pyrazol-5-yl]-1-phenylprop-2-en-1-one |
| PubChem CID | 122414064 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | (E)-3-[3-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]-1H-pyrazol-5-yl]-1-phenylprop-2-en-1-one |
| SMILES | COc1cc(-c2cc(/C=C/C(=O)c3ccccc3)[nH]n2)cc(CO)c1CO |
| InChI | InChI=1S/C21H20N2O4/c1-27-21-10-15(9-16(12-24)18(21)13-25)19-11-17(22-23-19)7-8-20(26)14-5-3-2-4-6-14/h2-11,24-25H,12-13H2,1H3,(H,22,23)/b8-7+ |
| InChIKey | DZZCZZAUNRITPX-BQYQJAHWSA-N |
| XLogP | 2.97 |
| TPSA | 95.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-[3-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]-1H-pyrazol-5-yl]-1-phenylprop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-[3-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]-1H-pyrazol-5-yl]-1-phenylprop-2-en-1-one?
The IUPAC name of (E)-3-[3-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]-1H-pyrazol-5-yl]-1-phenylprop-2-en-1-one (CID 122414064) is (E)-3-[3-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]-1H-pyrazol-5-yl]-1-phenylprop-2-en-1-one.
What is the SMILES notation for (E)-3-[3-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]-1H-pyrazol-5-yl]-1-phenylprop-2-en-1-one?
The canonical SMILES for (E)-3-[3-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]-1H-pyrazol-5-yl]-1-phenylprop-2-en-1-one is COc1cc(-c2cc(/C=C/C(=O)c3ccccc3)[nH]n2)cc(CO)c1CO.
What is the InChIKey of (E)-3-[3-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]-1H-pyrazol-5-yl]-1-phenylprop-2-en-1-one?
The InChIKey is DZZCZZAUNRITPX-BQYQJAHWSA-N. The full InChI is InChI=1S/C21H20N2O4/c1-27-21-10-15(9-16(12-24)18(21)13-25)19-11-17(22-23-19)7-8-20(26)14-5-3-2-4-6-14/h2-11,24-25H,12-13H2,1H3,(H,22,23)/b8-7+.
What are the key properties of (E)-3-[3-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]-1H-pyrazol-5-yl]-1-phenylprop-2-en-1-one?
(E)-3-[3-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]-1H-pyrazol-5-yl]-1-phenylprop-2-en-1-one has a molecular weight of 364.40 g/mol, XLogP of 2.97, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-[3-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]-1H-pyrazol-5-yl]-1-phenylprop-2-en-1-one is sourced from PubChem (CID 122414064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).