C22H20N2O4 — CID 122414198
(E)-3-[3-[3,4-bis(hydroxymethyl)phenyl]-1H-pyrazol-5-yl]-1-(2,3-dihydro-1-benzofuran-5-yl)prop-2-en-1-one (PubChem CID 122414198) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is (E)-3-[3-[3,4-bis(hydroxymethyl)phenyl]-1H-pyrazol-5-yl]-1-(2,3-dihydro-1-benzofuran-5-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[3-[3,4-bis(hydroxymethyl)phenyl]-1H-pyrazol-5-yl]-1-(2,3-dihydro-1-benzofuran-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 122414198 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | (E)-3-[3-[3,4-bis(hydroxymethyl)phenyl]-1H-pyrazol-5-yl]-1-(2,3-dihydro-1-benzofuran-5-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cc(-c2ccc(CO)c(CO)c2)n[nH]1)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C22H20N2O4/c25-12-17-2-1-14(9-18(17)13-26)20-11-19(23-24-20)4-5-21(27)15-3-6-22-16(10-15)7-8-28-22/h1-6,9-11,25-26H,7-8,12-13H2,(H,23,24)/b5-4+ |
| InChIKey | DTXNWNKALUGYBJ-SNAWJCMRSA-N |
| XLogP | 2.89 |
| TPSA | 95.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|